Products 505084-58-2
CAS 505084-58-2 is the registry number for 2-Chloro-5-(trifluoromethyl)isonicotinic acid, 98%. Offered by: Fluorochem. Available pack sizes: 5g, 10g, 25g, 100g.
2-chloro-5-(trifluoromethyl)pyridine-4-carboxylic acid (CAS 505084-58-2) is a chemical compound with the molecular formula C7H3ClF3NO2 and a molecular weight of 225.55 g/mol. IUPAC name: 2-chloro-5-(trifluoromethyl)pyridine-4-carboxylic acid. InChIKey: OIODRBHIESSYRO-UHFFFAOYSA-N.
| Molecular formula | C7H3ClF3NO2 |
|---|---|
| Molecular weight | 225.55 g/mol |
| IUPAC name | 2-chloro-5-(trifluoromethyl)pyridine-4-carboxylic acid |
| InChIKey | OIODRBHIESSYRO-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CN=C1Cl)C(F)(F)F)C(=O)O |
Computed by PubChem (NCBI)