Products 505088-42-6
CAS 505088-42-6 is the registry number for N-(4-Fluorophenyl)(5-methyl-3-phenylisoxazol-4-yl)formamide. Offered by: Biosynth. Available pack sizes: 250mg, 500mg, 1000mg, 2000mg, 5000mg.
N-(4-fluorophenyl)-5-methyl-3-phenyl-1,2-oxazole-4-carboxamide (CAS 505088-42-6) is a chemical compound with the molecular formula C17H13FN2O2 and a molecular weight of 296.29 g/mol. IUPAC name: N-(4-fluorophenyl)-5-methyl-3-phenyl-1,2-oxazole-4-carboxamide. InChIKey: OJZOXMKTAHNABR-UHFFFAOYSA-N.
| Molecular formula | C17H13FN2O2 |
|---|---|
| Molecular weight | 296.29 g/mol |
| IUPAC name | N-(4-fluorophenyl)-5-methyl-3-phenyl-1,2-oxazole-4-carboxamide |
| InChIKey | OJZOXMKTAHNABR-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NO1)C2=CC=CC=C2)C(=O)NC3=CC=C(C=C3)F |
Computed by PubChem (NCBI)