CAS 50689-43-5 appears in our catalog under these names: Ethyl 4-hydroxy-8-methoxy-3-methylquinoline-2-carboxylate, 95%, Ethyl 4-hydroxy-8-methoxy-3-methylquinoline-2-carboxylate. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
Ethyl 8-methoxy-3-methyl-4-oxo-1H-quinoline-2-carboxylate (CAS 50689-43-5) is a chemical compound with the molecular formula C14H15NO4 and a molecular weight of 261.27 g/mol. IUPAC name: ethyl 8-methoxy-3-methyl-4-oxo-1H-quinoline-2-carboxylate. InChIKey: FCVIMHFZWTWHLG-UHFFFAOYSA-N.
| Molecular formula | C14H15NO4 |
|---|---|
| Molecular weight | 261.27 g/mol |
| IUPAC name | ethyl 8-methoxy-3-methyl-4-oxo-1H-quinoline-2-carboxylate |
| InChIKey | FCVIMHFZWTWHLG-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C(=O)C2=C(N1)C(=CC=C2)OC)C |
Computed by PubChem (NCBI)