Products 50741-46-3
CAS 50741-46-3 appears in our catalog under these names: Ethyl quinoline–3–carboxylate, Ethyl quinoline-3-carboxylate 95%, ETHYL QUINOLINE-3-CARBOXYLATE, 98%, Ethyl quinoline-3-carboxylate, 95%, 95%. Offered by: GLPBio, Ambeed, Fluorochem, Chemat. Available pack sizes: 10g, 1g, 5g, 100mg, 250mg, 25g.
Ethyl quinoline-3-carboxylate (CAS 50741-46-3) is a chemical compound with the molecular formula C12H11NO2 and a molecular weight of 201.22 g/mol. IUPAC name: ethyl quinoline-3-carboxylate. InChIKey: OTTDACPMYLDVTL-UHFFFAOYSA-N.
| Molecular formula | C12H11NO2 |
|---|---|
| Molecular weight | 201.22 g/mol |
| IUPAC name | ethyl quinoline-3-carboxylate |
| InChIKey | OTTDACPMYLDVTL-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC2=CC=CC=C2N=C1 |
Computed by PubChem (NCBI)