CAS 50766-86-4 appears in our catalog under these names: 3-Nitrobutyrophenone, 95%, 3-Nitro-1-phenylbutan-1-one, 95+%, 3-Nitrobutyrophenone. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 2g.
1-(3-nitrophenyl)butan-1-one (CAS 50766-86-4) is a chemical compound with the molecular formula C10H11NO3 and a molecular weight of 193.20 g/mol. IUPAC name: 1-(3-nitrophenyl)butan-1-one. InChIKey: HJLRYDBRORTQIU-UHFFFAOYSA-N.
| Molecular formula | C10H11NO3 |
|---|---|
| Molecular weight | 193.20 g/mol |
| IUPAC name | 1-(3-nitrophenyl)butan-1-one |
| InChIKey | HJLRYDBRORTQIU-UHFFFAOYSA-N |
| SMILES | CCCC(=O)C1=CC(=CC=C1)[N+](=O)[O-] |
Computed by PubChem (NCBI)