CAS 5081-87-8 appears in our catalog under these names: 3-(2-Chloroethyl)quinazoline-2,4(1H,3H)-dione, 97%, 97%, 3-(2-Chloroethyl)quinazoline-2,4(1H,3H)-dione, 97%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 10g, 1g, 5g, 25g, 100g.
3-(2-chloroethyl)-1H-quinazoline-2,4-dione (CAS 5081-87-8) is a chemical compound with the molecular formula C10H9ClN2O2 and a molecular weight of 224.64 g/mol. IUPAC name: 3-(2-chloroethyl)-1H-quinazoline-2,4-dione. InChIKey: HWFSVCPXNLEACG-UHFFFAOYSA-N.
| Molecular formula | C10H9ClN2O2 |
|---|---|
| Molecular weight | 224.64 g/mol |
| IUPAC name | 3-(2-chloroethyl)-1H-quinazoline-2,4-dione |
| InChIKey | HWFSVCPXNLEACG-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)N(C(=O)N2)CCCl |
Computed by PubChem (NCBI)