CAS 5087-21-8 appears in our catalog under these names: trans–2–(4–methoxyphenyl)cyclopropane–1–carboxylic acid, (1R,2R)-2-(4-Methoxyphenyl)cyclopropanecarboxylic Acid, ≥95%, ≥95%. Offered by: GLPBio, Chemat. Available pack sizes: 1g, 250mg, 500mg, 100mg, 5g.
Trans-(1R,2R)-2-(4-methoxyphenyl)cyclopropane-1-carboxylic acid (CAS 5087-21-8) is a chemical compound with the molecular formula C11H12O3 and a molecular weight of 192.21 g/mol. IUPAC name: trans-(1R,2R)-2-(4-methoxyphenyl)cyclopropane-1-carboxylic acid. InChIKey: CCTYOCDEILYYEF-VHSXEESVSA-N.
| Molecular formula | C11H12O3 |
|---|---|
| Molecular weight | 192.21 g/mol |
| IUPAC name | trans-(1R,2R)-2-(4-methoxyphenyl)cyclopropane-1-carboxylic acid |
| InChIKey | CCTYOCDEILYYEF-VHSXEESVSA-N |
| SMILES | COC1=CC=C(C=C1)[C@@H]2C[C@H]2C(=O)O |
Computed by PubChem (NCBI)