Products 515179-21-2
CAS 515179-21-2 is the registry number for (1S,2S)-2-(4-Methoxyphenyl)cyclopropanecarboxylic Acid, ≥97%, ≥97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
Trans-(1S,2S)-2-(4-methoxyphenyl)cyclopropane-1-carboxylic acid (CAS 515179-21-2) is a chemical compound with the molecular formula C11H12O3 and a molecular weight of 192.21 g/mol. IUPAC name: trans-(1S,2S)-2-(4-methoxyphenyl)cyclopropane-1-carboxylic acid. InChIKey: CCTYOCDEILYYEF-ZJUUUORDSA-N.
| Molecular formula | C11H12O3 |
|---|---|
| Molecular weight | 192.21 g/mol |
| IUPAC name | trans-(1S,2S)-2-(4-methoxyphenyl)cyclopropane-1-carboxylic acid |
| InChIKey | CCTYOCDEILYYEF-ZJUUUORDSA-N |
| SMILES | COC1=CC=C(C=C1)[C@H]2C[C@@H]2C(=O)O |
Computed by PubChem (NCBI)