Products 50930-41-1
CAS 50930-41-1 is the registry number for Ethyl 3–aminobenzoate dihydrochloride. Offered by: GLPBio. Available pack sizes: 25g.
Ethyl 3-aminobenzoate;hydrochloride (CAS 50930-41-1) is a chemical compound with the molecular formula C9H12ClNO2 and a molecular weight of 201.65 g/mol. IUPAC name: ethyl 3-aminobenzoate;hydrochloride. InChIKey: XFCIMIQCFPNSMC-UHFFFAOYSA-N.
| Molecular formula | C9H12ClNO2 |
|---|---|
| Molecular weight | 201.65 g/mol |
| IUPAC name | ethyl 3-aminobenzoate;hydrochloride |
| InChIKey | XFCIMIQCFPNSMC-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC(=CC=C1)N.Cl |
Computed by PubChem (NCBI)
Synonyms:
tricaine hydrochloride, Benzoic acid, 3-amino-, ethyl ester, hydrochloride, ethyl 3-aminobenzoate hydrochloride, ethyl 3-aminobenzoate;hydrochloride, ethyl 3-aminobenzoate dihydrochloride, ethyl 3-aminobenzoate-hydrochloride, ETHYL M-AMINOBENZOATE HYDROCHLORIDE, Ethyl 3-aminobenzoate--hydrogen chloride (1/1)