Products 50961-68-7
CAS 50961-68-7 appears in our catalog under these names: (1S,2S)-2-Amino-1-(4-aminophenyl)propane-1,3-diol, 95%, L-(+)-threo-2-Amino-1-(4-aminophenyl)-1,3-propanediol, (1S,2S)-2-Amino-1-(4-aminophenyl)propane-1,3-diol, 98%. Offered by: Combi-blocks, Biosynth, Chemat, Fluorochem. Available pack sizes: 100mg, 5g, 10g, 1g, 250mg, 2g, 25g.
(1S,2S)-2-amino-1-(4-aminophenyl)propane-1,3-diol (CAS 50961-68-7) is a chemical compound with the molecular formula C9H14N2O2 and a molecular weight of 182.22 g/mol. IUPAC name: (1S,2S)-2-amino-1-(4-aminophenyl)propane-1,3-diol. InChIKey: HOSHJSFGXZIFCZ-IUCAKERBSA-N.
| Molecular formula | C9H14N2O2 |
|---|---|
| Molecular weight | 182.22 g/mol |
| IUPAC name | (1S,2S)-2-amino-1-(4-aminophenyl)propane-1,3-diol |
| InChIKey | HOSHJSFGXZIFCZ-IUCAKERBSA-N |
| SMILES | C1=CC(=CC=C1[C@@H]([C@H](CO)N)O)N |
Computed by PubChem (NCBI)