CAS 50995-74-9 appears in our catalog under these names: 7ACC1/ 98%, 7ACC1, 7-Diethylaminocoumarin-3-carboxylic acid, 7-(Diethylamino)coumarin-3-carboxylic Acid, >98.0%(GC)(T), 7ACC1 98%. Offered by: TargetMol, GLPBio, Chemat, TCI, Ambeed. Available pack sizes: 200mg, 100mg, 1g, 25mg, 250mg, 5g, 25g, 100g.
7-(diethylamino)-2-oxochromene-3-carboxylic acid (CAS 50995-74-9) is a chemical compound with the molecular formula C14H15NO4 and a molecular weight of 261.27 g/mol. IUPAC name: 7-(diethylamino)-2-oxochromene-3-carboxylic acid. InChIKey: WHCPTFFIERCDSB-UHFFFAOYSA-N.
| Molecular formula | C14H15NO4 |
|---|---|
| Molecular weight | 261.27 g/mol |
| IUPAC name | 7-(diethylamino)-2-oxochromene-3-carboxylic acid |
| InChIKey | WHCPTFFIERCDSB-UHFFFAOYSA-N |
| SMILES | CCN(CC)C1=CC2=C(C=C1)C=C(C(=O)O2)C(=O)O |
Computed by PubChem (NCBI)