CAS 51035-40-6 appears in our catalog under these names: 4-(Pyridin-2-yl)phenol, 95%, 95%, 4-(Pyridin-2-yl)phenol, 97%. Offered by: Chemat, Fluorochem. Available pack sizes: 1g, 5g, 10g, 25g, 100g.
4-pyridin-2-ylphenol (CAS 51035-40-6) is a chemical compound with the molecular formula C11H9NO and a molecular weight of 171.19 g/mol. IUPAC name: 4-pyridin-2-ylphenol. InChIKey: VQHMPVXKDCHHSR-UHFFFAOYSA-N.
| Molecular formula | C11H9NO |
|---|---|
| Molecular weight | 171.19 g/mol |
| IUPAC name | 4-pyridin-2-ylphenol |
| InChIKey | VQHMPVXKDCHHSR-UHFFFAOYSA-N |
| SMILES | C1=CC=NC(=C1)C2=CC=C(C=C2)O |
Computed by PubChem (NCBI)