CAS 512809-36-8 is the registry number for 3-Formylphenyl 1-methyl-1H-pyrazole-5-carboxylate. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
(3-formylphenyl) 2-methylpyrazole-3-carboxylate (CAS 512809-36-8) is a chemical compound with the molecular formula C12H10N2O3 and a molecular weight of 230.22 g/mol. IUPAC name: (3-formylphenyl) 2-methylpyrazole-3-carboxylate. InChIKey: ROSFYAOJYLQCGG-UHFFFAOYSA-N.
| Molecular formula | C12H10N2O3 |
|---|---|
| Molecular weight | 230.22 g/mol |
| IUPAC name | (3-formylphenyl) 2-methylpyrazole-3-carboxylate |
| InChIKey | ROSFYAOJYLQCGG-UHFFFAOYSA-N |
| SMILES | CN1C(=CC=N1)C(=O)OC2=CC=CC(=C2)C=O |
Computed by PubChem (NCBI)