CAS 51329-15-8 appears in our catalog under these names: Methyl 3,5-dibromobenzoate, 98% , 3,5-Dibromobenzoic acid methyl ester, Methyl 3,5-Dibromobenzoate, >98.0%(GC), METHYL 3,5-DIBROMOBENZOATE, 98%, 98%, Methyl 3,5-dibromobenzoate, 95%. Offered by: Thermo Scientific (Alfa Aesar), Biosynth, TCI, Chemat, Fluorochem. Available pack sizes: 5g, 50g, 25g, 1g, 10g, 100g, 500g.
Methyl 3,5-dibromobenzoate (CAS 51329-15-8) is a chemical compound with the molecular formula C8H6Br2O2 and a molecular weight of 293.94 g/mol. IUPAC name: methyl 3,5-dibromobenzoate. InChIKey: GSMAWUZTAIOCPL-UHFFFAOYSA-N.
| Molecular formula | C8H6Br2O2 |
|---|---|
| Molecular weight | 293.94 g/mol |
| IUPAC name | methyl 3,5-dibromobenzoate |
| InChIKey | GSMAWUZTAIOCPL-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=CC(=C1)Br)Br |
Computed by PubChem (NCBI)