Products 51359-76-3
CAS 51359-76-3 is the registry number for (R)-2-(3,4-Dichlorophenyl)-2-hydroxyacetic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(2R)-2-(3,4-dichlorophenyl)-2-hydroxyacetic acid (CAS 51359-76-3) is a chemical compound with the molecular formula C8H6Cl2O3 and a molecular weight of 221.03 g/mol. IUPAC name: (2R)-2-(3,4-dichlorophenyl)-2-hydroxyacetic acid. InChIKey: TZCCKRXYTBHLMH-SSDOTTSWSA-N.
| Molecular formula | C8H6Cl2O3 |
|---|---|
| Molecular weight | 221.03 g/mol |
| IUPAC name | (2R)-2-(3,4-dichlorophenyl)-2-hydroxyacetic acid |
| InChIKey | TZCCKRXYTBHLMH-SSDOTTSWSA-N |
| SMILES | C1=CC(=C(C=C1[C@H](C(=O)O)O)Cl)Cl |
Computed by PubChem (NCBI)