CAS 515135-65-6 appears in our catalog under these names: 5-Bromo-2-fluoro-4-methylbenzoic acid, 98%, 5–Bromo–2–fluoro–4–methylbenzoic acid, 5-Bromo-2-fluoro-4-methylbenzoic acid, 5-Bromo-2-fluoro-4-methylbenzoic acid 98%, 5-Bromo-2-fluoro-4-methylbenzoic acid, 98%, 98%. Offered by: Combi-blocks, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 1g, 25g, 10g, 5g, 100mg, 250mg, 50g, 100g.
5-bromo-2-fluoro-4-methylbenzoic acid (CAS 515135-65-6) is a chemical compound with the molecular formula C8H6BrFO2 and a molecular weight of 233.03 g/mol. IUPAC name: 5-bromo-2-fluoro-4-methylbenzoic acid. InChIKey: BGBAXZILVNOSAT-UHFFFAOYSA-N.
| Molecular formula | C8H6BrFO2 |
|---|---|
| Molecular weight | 233.03 g/mol |
| IUPAC name | 5-bromo-2-fluoro-4-methylbenzoic acid |
| InChIKey | BGBAXZILVNOSAT-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1Br)C(=O)O)F |
Computed by PubChem (NCBI)