Products 5153-92-4
CAS 5153-92-4 is the registry number for (+)-Sclareol oxide. Offered by: MedChemExpress. Available pack sizes: Get quote.
(4aR,6aS,10aS,10bR)-3,4a,7,7,10a-pentamethyl-1,5,6,6a,8,9,10,10b-octahydrobenzo[f]chromene (CAS 5153-92-4) is a chemical compound with the molecular formula C18H30O and a molecular weight of 262.4 g/mol. IUPAC name: (4aR,6aS,10aS,10bR)-3,4a,7,7,10a-pentamethyl-1,5,6,6a,8,9,10,10b-octahydrobenzo[f]chromene. InChIKey: LAEIZWJAQRGPDA-CIRFHOKZSA-N.
| Molecular formula | C18H30O |
|---|---|
| Molecular weight | 262.4 g/mol |
| IUPAC name | (4aR,6aS,10aS,10bR)-3,4a,7,7,10a-pentamethyl-1,5,6,6a,8,9,10,10b-octahydrobenzo[f]chromene |
| InChIKey | LAEIZWJAQRGPDA-CIRFHOKZSA-N |
| SMILES | CC1=CC[C@@H]2[C@]3(CCCC([C@@H]3CC[C@]2(O1)C)(C)C)C |
Computed by PubChem (NCBI)