Products 5159-59-1
CAS 5159-59-1 appears in our catalog under these names: Methyl 6-Amino-2-naphthoate, Methyl 6–Amino–2–naphthoate, Methyl 6-Amino-2-naphthoate, >98.0%(GC)(T), Methyl 6-amino-2-naphthoate 95%, Methyl 6-Amino-2-Naphthoate, 95%, 95%. Offered by: TRC, GLPBio, TCI, Ambeed, Chemat. Available pack sizes: 5g, 200mg, 1g, 250mg, 25g, 100mg, 10g.
Methyl 6-aminonaphthalene-2-carboxylate (CAS 5159-59-1) is a chemical compound with the molecular formula C12H11NO2 and a molecular weight of 201.22 g/mol. IUPAC name: methyl 6-aminonaphthalene-2-carboxylate. InChIKey: LPXVPYIHRFOTJZ-UHFFFAOYSA-N.
| Molecular formula | C12H11NO2 |
|---|---|
| Molecular weight | 201.22 g/mol |
| IUPAC name | methyl 6-aminonaphthalene-2-carboxylate |
| InChIKey | LPXVPYIHRFOTJZ-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC2=C(C=C1)C=C(C=C2)N |
Computed by PubChem (NCBI)