CAS 5159-63-7 appears in our catalog under these names: Methyl 7-bromo-2-naphthoate, 98%, Methyl 7-bromo-2-naphthoate, 98%, 98%, 7-Bromo-naphthalene-2-carboxylic acid methyl ester, 98%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 50mg, 100mg, 1g, 250mg, 500mg.
Methyl 7-bromonaphthalene-2-carboxylate (CAS 5159-63-7) is a chemical compound with the molecular formula C12H9BrO2 and a molecular weight of 265.10 g/mol. IUPAC name: methyl 7-bromonaphthalene-2-carboxylate. InChIKey: COJFEPBVZMXUES-UHFFFAOYSA-N.
| Molecular formula | C12H9BrO2 |
|---|---|
| Molecular weight | 265.10 g/mol |
| IUPAC name | methyl 7-bromonaphthalene-2-carboxylate |
| InChIKey | COJFEPBVZMXUES-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC2=C(C=C1)C=CC(=C2)Br |
Computed by PubChem (NCBI)