CAS 51644-83-8 appears in our catalog under these names: Z–D–Glu(OtBu)–OH, Z-D-Glu(OtBu)-OH, N-Benzyloxycarbonyl-D-glutamic-acid 5-tert-butyl ester, 98% , Z-D-Glu(OtBu)-OH 98%, Z-D-Glu(OtBu)-OH, 98%, 98%. Offered by: GLPBio, TargetMol, Thermo Scientific (Alfa Aesar), Ambeed, Chemat. Available pack sizes: 25g, 50mg, 100mg, 5g, 1g, 100g, 500g, 10g.
(2R)-5-[(2-methylpropan-2-yl)oxy]-5-oxo-2-(phenylmethoxycarbonylamino)pentanoic acid (CAS 51644-83-8) is a chemical compound with the molecular formula C17H23NO6 and a molecular weight of 337.4 g/mol. IUPAC name: (2R)-5-[(2-methylpropan-2-yl)oxy]-5-oxo-2-(phenylmethoxycarbonylamino)pentanoic acid. InChIKey: GLMODRZPPBZPPB-CYBMUJFWSA-N.
| Molecular formula | C17H23NO6 |
|---|---|
| Molecular weight | 337.4 g/mol |
| IUPAC name | (2R)-5-[(2-methylpropan-2-yl)oxy]-5-oxo-2-(phenylmethoxycarbonylamino)pentanoic acid |
| InChIKey | GLMODRZPPBZPPB-CYBMUJFWSA-N |
| SMILES | CC(C)(C)OC(=O)CC[C@H](C(=O)O)NC(=O)OCC1=CC=CC=C1 |
Computed by PubChem (NCBI)