cas: 51644-83-8 — see every product listed under this CAS number, including other names
z-d-glu(otbu)-oh, 98% (CAS 51644-83-8) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 100g, 500g, 1g. Offered by: Fluorochem, Ambeed.
| brand | Fluorochem |
|---|---|
| catalog number | F045481-5G |
| cas | 51644-83-8 |
| size | 5g |
| availability | In Stock UK |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 112.48 Pln | |
| Fluorochem | 10g | 169.75 Pln | |
| Fluorochem | 25g | 247.85 Pln | |
| Fluorochem | 100g | 497.76 Pln | |
| Fluorochem | 500g | 2215.90 Pln | |
| Ambeed | 1g | 125.62 Pln | |
| Ambeed | 5g | 147.88 Pln | |
| Ambeed | 25g | 253.56 Pln | |
| Ambeed | 100g | 487.19 Pln | |
| Ambeed | 500g | 2155.94 Pln |
| purity | 98% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 1-2 weeks |
| category | Odczynniki chemiczne |
(2R)-5-[(2-methylpropan-2-yl)oxy]-5-oxo-2-(phenylmethoxycarbonylamino)pentanoic acid (CAS 51644-83-8) is a chemical compound with the molecular formula C17H23NO6 and a molecular weight of 337.4 g/mol. IUPAC name: (2R)-5-[(2-methylpropan-2-yl)oxy]-5-oxo-2-(phenylmethoxycarbonylamino)pentanoic acid. InChIKey: GLMODRZPPBZPPB-CYBMUJFWSA-N.
| Molecular formula | C17H23NO6 |
|---|---|
| Molecular weight | 337.4 g/mol |
| IUPAC name | (2R)-5-[(2-methylpropan-2-yl)oxy]-5-oxo-2-(phenylmethoxycarbonylamino)pentanoic acid |
| InChIKey | GLMODRZPPBZPPB-CYBMUJFWSA-N |
| SMILES | CC(C)(C)OC(=O)CC[C@H](C(=O)O)NC(=O)OCC1=CC=CC=C1 |
Computed by PubChem (NCBI)