CAS 51672-78-7 is the registry number for 2-(4-oxo-1,2,3-benzotriazin-3(4H)-yl)propanoic acid, 95%. Offered by: AmBeed. Available pack sizes: 5g, 10g.
2-(4-oxo-1,2,3-benzotriazin-3-yl)propanoic acid (CAS 51672-78-7) is a chemical compound with the molecular formula C10H9N3O3 and a molecular weight of 219.20 g/mol. IUPAC name: 2-(4-oxo-1,2,3-benzotriazin-3-yl)propanoic acid. InChIKey: HWXISOGIRJVVTE-UHFFFAOYSA-N.
| Molecular formula | C10H9N3O3 |
|---|---|
| Molecular weight | 219.20 g/mol |
| IUPAC name | 2-(4-oxo-1,2,3-benzotriazin-3-yl)propanoic acid |
| InChIKey | HWXISOGIRJVVTE-UHFFFAOYSA-N |
| SMILES | CC(C(=O)O)N1C(=O)C2=CC=CC=C2N=N1 |
Computed by PubChem (NCBI)