CAS 5174-92-5 is the registry number for 3-Phenyl-1,2-dihydro-1,8-naphthyridin-2-one. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
3-phenyl-1H-1,8-naphthyridin-2-one (CAS 5174-92-5) is a chemical compound with the molecular formula C14H10N2O and a molecular weight of 222.24 g/mol. IUPAC name: 3-phenyl-1H-1,8-naphthyridin-2-one. InChIKey: BILQDKWMYLRKKH-UHFFFAOYSA-N.
| Molecular formula | C14H10N2O |
|---|---|
| Molecular weight | 222.24 g/mol |
| IUPAC name | 3-phenyl-1H-1,8-naphthyridin-2-one |
| InChIKey | BILQDKWMYLRKKH-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC3=C(NC2=O)N=CC=C3 |
Computed by PubChem (NCBI)