Products 51971-09-6
CAS 51971-09-6 is the registry number for Glycozolidal, 99.92%. Offered by: MedChemExpress. Available pack sizes: 25 mg, 10 mg, 5 mg.
2,6-dimethoxy-9H-carbazole-3-carbaldehyde (CAS 51971-09-6) is a chemical compound with the molecular formula C15H13NO3 and a molecular weight of 255.27 g/mol. IUPAC name: 2,6-dimethoxy-9H-carbazole-3-carbaldehyde. InChIKey: WCKFRKXQABCDRE-UHFFFAOYSA-N.
| Molecular formula | C15H13NO3 |
|---|---|
| Molecular weight | 255.27 g/mol |
| IUPAC name | 2,6-dimethoxy-9H-carbazole-3-carbaldehyde |
| InChIKey | WCKFRKXQABCDRE-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C=C1)NC3=C2C=C(C(=C3)OC)C=O |
Computed by PubChem (NCBI)