CAS 51997-50-3 appears in our catalog under these names: Carvedilol Impurity 28, Carvedilol Impurity 25. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
3-(oxiran-2-ylmethoxy)-9H-carbazole (CAS 51997-50-3) is a chemical compound with the molecular formula C15H13NO2 and a molecular weight of 239.27 g/mol. IUPAC name: 3-(oxiran-2-ylmethoxy)-9H-carbazole. InChIKey: WXRASJNZZKLKBC-UHFFFAOYSA-N.
| Molecular formula | C15H13NO2 |
|---|---|
| Molecular weight | 239.27 g/mol |
| IUPAC name | 3-(oxiran-2-ylmethoxy)-9H-carbazole |
| InChIKey | WXRASJNZZKLKBC-UHFFFAOYSA-N |
| SMILES | C1C(O1)COC2=CC3=C(C=C2)NC4=CC=CC=C43 |
Computed by PubChem (NCBI)