CAS 52095-18-8 appears in our catalog under these names: 3,5-Dimethyl-2-nitrobenzoic acid, 98%, 3，5–Dimethyl–2–nitrobenzoic acid, 3,5-Dimethyl-2-nitrobenzoic acid, 98%, 98%. Offered by: Combi-blocks, AmBeed, GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 100mg, 250mg.
3,5-dimethyl-2-nitrobenzoic acid (CAS 52095-18-8) is a chemical compound with the molecular formula C9H9NO4 and a molecular weight of 195.17 g/mol. IUPAC name: 3,5-dimethyl-2-nitrobenzoic acid. InChIKey: HGFCXXRETYVGMH-UHFFFAOYSA-N.
| Molecular formula | C9H9NO4 |
|---|---|
| Molecular weight | 195.17 g/mol |
| IUPAC name | 3,5-dimethyl-2-nitrobenzoic acid |
| InChIKey | HGFCXXRETYVGMH-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1)C(=O)O)[N+](=O)[O-])C |
Computed by PubChem (NCBI)