Products 521278-63-7
CAS 521278-63-7 is the registry number for methyl 2-nitrilo-3-(3-phenoxyphenyl)prop-2-enoate. Offered by: Biosynth. Available pack sizes: 250mg.
Methyl (Z)-2-cyano-3-(3-phenoxyphenyl)prop-2-enoate (CAS 521278-63-7) is a chemical compound with the molecular formula C17H13NO3 and a molecular weight of 279.29 g/mol. IUPAC name: methyl (Z)-2-cyano-3-(3-phenoxyphenyl)prop-2-enoate. InChIKey: FDZOJAHXJKNRMS-UVTDQMKNSA-N.
| Molecular formula | C17H13NO3 |
|---|---|
| Molecular weight | 279.29 g/mol |
| IUPAC name | methyl (Z)-2-cyano-3-(3-phenoxyphenyl)prop-2-enoate |
| InChIKey | FDZOJAHXJKNRMS-UVTDQMKNSA-N |
| SMILES | COC(=O)/C(=C\C1=CC(=CC=C1)OC2=CC=CC=C2)/C#N |
Computed by PubChem (NCBI)