CAS 5213-17-2 is the registry number for 4-Fluoro-2-methoxybenzoyl chloride, 98%. Offered by: AmBeed. Available pack sizes: 25g.
4-fluoro-2-methoxybenzoyl chloride (CAS 5213-17-2) is a chemical compound with the molecular formula C8H6ClFO2 and a molecular weight of 188.58 g/mol. IUPAC name: 4-fluoro-2-methoxybenzoyl chloride. InChIKey: KOHPYCKBINGPFW-UHFFFAOYSA-N.
| Molecular formula | C8H6ClFO2 |
|---|---|
| Molecular weight | 188.58 g/mol |
| IUPAC name | 4-fluoro-2-methoxybenzoyl chloride |
| InChIKey | KOHPYCKBINGPFW-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC(=C1)F)C(=O)Cl |
Computed by PubChem (NCBI)