CAS 52189-36-3 is the registry number for Methyl 3-acetamidobenzoate, 97%. Offered by: AmBeed. Available pack sizes: 5g.
Methyl 3-acetamidobenzoate (CAS 52189-36-3) is a chemical compound with the molecular formula C10H11NO3 and a molecular weight of 193.20 g/mol. IUPAC name: methyl 3-acetamidobenzoate. InChIKey: BMBOHBXLLAKPHP-UHFFFAOYSA-N.
| Molecular formula | C10H11NO3 |
|---|---|
| Molecular weight | 193.20 g/mol |
| IUPAC name | methyl 3-acetamidobenzoate |
| InChIKey | BMBOHBXLLAKPHP-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=CC=CC(=C1)C(=O)OC |
Computed by PubChem (NCBI)