Products 52189-67-0
CAS 52189-67-0 appears in our catalog under these names: 3-Fluoro-2,6-dimethoxybenzoic acid, 97%, 3-Fluoro-2,6-dimethoxybenzoic acid, 3-Fluoro-2,6-dimethoxybenzoic acid, ≥95%, ≥95%. Offered by: AmBeed, Biosynth, Chemat. Available pack sizes: 1g, 50mg, 0,5g.
3-fluoro-2,6-dimethoxybenzoic acid (CAS 52189-67-0) is a chemical compound with the molecular formula C9H9FO4 and a molecular weight of 200.16 g/mol. IUPAC name: 3-fluoro-2,6-dimethoxybenzoic acid. InChIKey: JDFSNRMZEUTEFU-UHFFFAOYSA-N.
| Molecular formula | C9H9FO4 |
|---|---|
| Molecular weight | 200.16 g/mol |
| IUPAC name | 3-fluoro-2,6-dimethoxybenzoic acid |
| InChIKey | JDFSNRMZEUTEFU-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=C(C=C1)F)OC)C(=O)O |
Computed by PubChem (NCBI)