Products 52240-14-9
CAS 52240-14-9 is the registry number for 4-(2,5-Dichlorophenyl)-4-oxobutanoic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
4-(2,5-dichlorophenyl)-4-oxobutanoic acid (CAS 52240-14-9) is a chemical compound with the molecular formula C10H8Cl2O3 and a molecular weight of 247.07 g/mol. IUPAC name: 4-(2,5-dichlorophenyl)-4-oxobutanoic acid. InChIKey: FZLOKTSWFCRCNC-UHFFFAOYSA-N.
| Molecular formula | C10H8Cl2O3 |
|---|---|
| Molecular weight | 247.07 g/mol |
| IUPAC name | 4-(2,5-dichlorophenyl)-4-oxobutanoic acid |
| InChIKey | FZLOKTSWFCRCNC-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)C(=O)CCC(=O)O)Cl |
Computed by PubChem (NCBI)