Products 52240-15-0
CAS 52240-15-0 appears in our catalog under these names: 4-(3-Aminophenyl)-4-oxobutanoic acid, 4-(3-Aminophenyl)-4-oxobutanoic acid, 95%. Offered by: Biosynth, Ambeed, BLDpharm, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 250mg.
4-(3-aminophenyl)-4-oxobutanoic acid (CAS 52240-15-0) is a chemical compound with the molecular formula C10H11NO3 and a molecular weight of 193.20 g/mol. IUPAC name: 4-(3-aminophenyl)-4-oxobutanoic acid. InChIKey: OXYYRRANNTYYIP-UHFFFAOYSA-N.
| Molecular formula | C10H11NO3 |
|---|---|
| Molecular weight | 193.20 g/mol |
| IUPAC name | 4-(3-aminophenyl)-4-oxobutanoic acid |
| InChIKey | OXYYRRANNTYYIP-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)N)C(=O)CCC(=O)O |
Computed by PubChem (NCBI)