Products 52241-03-9

CAS 52241-03-9 is the registry number for Levosimendan Impurity 23. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

4-(3-aminophenyl)-3-methyl-4-oxobutanoic acid (CAS 52241-03-9) is a chemical compound with the molecular formula C11H13NO3 and a molecular weight of 207.23 g/mol. IUPAC name: 4-(3-aminophenyl)-3-methyl-4-oxobutanoic acid. InChIKey: ZLNBZCCWGIKDGQ-UHFFFAOYSA-N.

Identity
Molecular formulaC11H13NO3
Molecular weight207.23 g/mol
IUPAC name4-(3-aminophenyl)-3-methyl-4-oxobutanoic acid
InChIKeyZLNBZCCWGIKDGQ-UHFFFAOYSA-N
SMILESCC(CC(=O)O)C(=O)C1=CC(=CC=C1)N

Computed by PubChem (NCBI)