CAS 52241-03-9 is the registry number for Levosimendan Impurity 23. Offered by: Chemat Brand. Available pack sizes: on request.
4-(3-aminophenyl)-3-methyl-4-oxobutanoic acid (CAS 52241-03-9) is a chemical compound with the molecular formula C11H13NO3 and a molecular weight of 207.23 g/mol. IUPAC name: 4-(3-aminophenyl)-3-methyl-4-oxobutanoic acid. InChIKey: ZLNBZCCWGIKDGQ-UHFFFAOYSA-N.
| Molecular formula | C11H13NO3 |
|---|---|
| Molecular weight | 207.23 g/mol |
| IUPAC name | 4-(3-aminophenyl)-3-methyl-4-oxobutanoic acid |
| InChIKey | ZLNBZCCWGIKDGQ-UHFFFAOYSA-N |
| SMILES | CC(CC(=O)O)C(=O)C1=CC(=CC=C1)N |
Computed by PubChem (NCBI)