Products 52329-46-1
CAS 52329-46-1 is the registry number for H-Pro-Tyr-NH2·HCl. Offered by: Biosynth. Available pack sizes: 1000mg, 2000mg, 5000mg.
(2S)-N-[(2S)-1-amino-3-(4-hydroxyphenyl)-1-oxopropan-2-yl]pyrrolidine-2-carboxamide (CAS 52329-46-1) is a chemical compound with the molecular formula C14H19N3O3 and a molecular weight of 277.32 g/mol. IUPAC name: (2S)-N-[(2S)-1-amino-3-(4-hydroxyphenyl)-1-oxopropan-2-yl]pyrrolidine-2-carboxamide. InChIKey: FYSOVNFPTBIWBY-RYUDHWBXSA-N.
| Molecular formula | C14H19N3O3 |
|---|---|
| Molecular weight | 277.32 g/mol |
| IUPAC name | (2S)-N-[(2S)-1-amino-3-(4-hydroxyphenyl)-1-oxopropan-2-yl]pyrrolidine-2-carboxamide |
| InChIKey | FYSOVNFPTBIWBY-RYUDHWBXSA-N |
| SMILES | C1C[C@H](NC1)C(=O)N[C@@H](CC2=CC=C(C=C2)O)C(=O)N |
Computed by PubChem (NCBI)