Products 5241-71-4
CAS 5241-71-4 appears in our catalog under these names: H-Asp-Phe-NH2 trifluoroacetate, H-Asp-Phe-NH2. Offered by: Biosynth. Available pack sizes: 0,1g, 2000mg, 0,25g, 1000mg, 0,5g, 5000mg, 1g.
(3S)-3-amino-4-[[(2S)-1-amino-1-oxo-3-phenylpropan-2-yl]amino]-4-oxobutanoic acid (CAS 5241-71-4) is a chemical compound with the molecular formula C13H17N3O4 and a molecular weight of 279.29 g/mol. IUPAC name: (3S)-3-amino-4-[[(2S)-1-amino-1-oxo-3-phenylpropan-2-yl]amino]-4-oxobutanoic acid. InChIKey: KPAUJSXYKQJSSO-UWVGGRQHSA-N.
| Molecular formula | C13H17N3O4 |
|---|---|
| Molecular weight | 279.29 g/mol |
| IUPAC name | (3S)-3-amino-4-[[(2S)-1-amino-1-oxo-3-phenylpropan-2-yl]amino]-4-oxobutanoic acid |
| InChIKey | KPAUJSXYKQJSSO-UWVGGRQHSA-N |
| SMILES | C1=CC=C(C=C1)C[C@@H](C(=O)N)NC(=O)[C@H](CC(=O)O)N |
Computed by PubChem (NCBI)
Synonyms:
aspartyl-phenylalanine amide