CAS 52549-07-2 appears in our catalog under these names: Pranoprofen Impurity 14, Pranoprofen Impurity 15, 2-(5H-Chromeno[2,3-b]pyridin-7-yl)acetic acid, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(5H-chromeno[2,3-b]pyridin-7-yl)acetic acid (CAS 52549-07-2) is a chemical compound with the molecular formula C14H11NO3 and a molecular weight of 241.24 g/mol. IUPAC name: 2-(5H-chromeno[2,3-b]pyridin-7-yl)acetic acid. InChIKey: KFCLXFOOVXFBNL-UHFFFAOYSA-N.
| Molecular formula | C14H11NO3 |
|---|---|
| Molecular weight | 241.24 g/mol |
| IUPAC name | 2-(5H-chromeno[2,3-b]pyridin-7-yl)acetic acid |
| InChIKey | KFCLXFOOVXFBNL-UHFFFAOYSA-N |
| SMILES | C1C2=C(N=CC=C2)OC3=C1C=C(C=C3)CC(=O)O |
Computed by PubChem (NCBI)