Products 52629-44-4
CAS 52629-44-4 appears in our catalog under these names: 4-Isopropylphenylacetyl chloride, 95%, 2-(4-Isopropylphenyl)acetyl chloride, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 100mg.
2-(4-propan-2-ylphenyl)acetyl chloride (CAS 52629-44-4) is a chemical compound with the molecular formula C11H13ClO and a molecular weight of 196.67 g/mol. IUPAC name: 2-(4-propan-2-ylphenyl)acetyl chloride. InChIKey: UHVGNVUYVXIYSH-UHFFFAOYSA-N.
| Molecular formula | C11H13ClO |
|---|---|
| Molecular weight | 196.67 g/mol |
| IUPAC name | 2-(4-propan-2-ylphenyl)acetyl chloride |
| InChIKey | UHVGNVUYVXIYSH-UHFFFAOYSA-N |
| SMILES | CC(C)C1=CC=C(C=C1)CC(=O)Cl |
Computed by PubChem (NCBI)