CAS 52629-46-6 appears in our catalog under these names: Mesitylacetyl chloride, 95%, 2-Mesitylacetyl chloride, 97%, 2-Mesitylacetyl chloride 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 25g, 5g.
2-(2,4,6-trimethylphenyl)acetyl chloride (CAS 52629-46-6) is a chemical compound with the molecular formula C11H13ClO and a molecular weight of 196.67 g/mol. IUPAC name: 2-(2,4,6-trimethylphenyl)acetyl chloride. InChIKey: NXCYVLQDRHQRHC-UHFFFAOYSA-N.
| Molecular formula | C11H13ClO |
|---|---|
| Molecular weight | 196.67 g/mol |
| IUPAC name | 2-(2,4,6-trimethylphenyl)acetyl chloride |
| InChIKey | NXCYVLQDRHQRHC-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1)C)CC(=O)Cl)C |
Computed by PubChem (NCBI)