CAS 52794-99-7 appears in our catalog under these names: L-3,4-Dichlorophenylalanine, 98%, H–Phe(3,4–DiCl)–OH, H-L-Phe(3,4-Cl2)-OH, 3,4-Dichloro-L-phenylalanine, 98%, 98%, 3,4-Dichlorophenylalanine. Offered by: Combi-blocks, GLPBio, Iris Biotech, Chemat, Fluorochem. Available pack sizes: 100g, 10g, 5g, 25g, 1g, 250mg.
(2S)-2-amino-3-(3,4-dichlorophenyl)propanoic acid (CAS 52794-99-7) is a chemical compound with the molecular formula C9H9Cl2NO2 and a molecular weight of 234.08 g/mol. IUPAC name: (2S)-2-amino-3-(3,4-dichlorophenyl)propanoic acid. InChIKey: NRCSJHVDTAAISV-QMMMGPOBSA-N.
| Molecular formula | C9H9Cl2NO2 |
|---|---|
| Molecular weight | 234.08 g/mol |
| IUPAC name | (2S)-2-amino-3-(3,4-dichlorophenyl)propanoic acid |
| InChIKey | NRCSJHVDTAAISV-QMMMGPOBSA-N |
| SMILES | C1=CC(=C(C=C1C[C@@H](C(=O)O)N)Cl)Cl |
Computed by PubChem (NCBI)