CAS 52980-06-0 appears in our catalog under these names: 6-Methoxy-4-oxo-1,4-dihydroquinoline-2-carboxylic acid, 95%, 6-Methoxy-4-oxo-1,4-dihydro-quinoline-2-carboxylic acid. Offered by: Combi-blocks, Biosynth. Available pack sizes: 5g, 1g, 10g.
6-methoxy-4-oxo-1H-quinoline-2-carboxylic acid (CAS 52980-06-0) is a chemical compound with the molecular formula C11H9NO4 and a molecular weight of 219.19 g/mol. IUPAC name: 6-methoxy-4-oxo-1H-quinoline-2-carboxylic acid. InChIKey: XQWCILGCSOTHNP-UHFFFAOYSA-N.
| Molecular formula | C11H9NO4 |
|---|---|
| Molecular weight | 219.19 g/mol |
| IUPAC name | 6-methoxy-4-oxo-1H-quinoline-2-carboxylic acid |
| InChIKey | XQWCILGCSOTHNP-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C=C1)NC(=CC2=O)C(=O)O |
Computed by PubChem (NCBI)