CAS 53163-53-4 is the registry number for (2E,4E,6E,8E,10E)-4,9-Dimethyl-2,4,6,8,10-dodecapentaenedial, 95%, 95%. Offered by: Chemat. Available pack sizes: 10mg, 25mg, 100mg.
4,9-dimethyldodeca-2,4,6,8,10-pentaenedial is a 1,12-dialdehyde compound having double bonds in the 2-, 4-, 6-, 8-, and 10-positions and methyl substituents in the 4- and 9-positions. It is a dialdehyde, an enal and an apo carotenoid.
Source: ChEBI
| Molecular formula | C14H16O2 |
|---|---|
| Molecular weight | 216.27 g/mol |
| IUPAC name | (2E,4E,6E,8E,10E)-4,9-dimethyldodeca-2,4,6,8,10-pentaenedial |
| InChIKey | QXJSYJRWEUENRT-PSAUJTBTSA-N |
| SMILES | C/C(=C\C=C\C=C(\C=C\C=O)/C)/C=C/C=O |
Computed by PubChem (NCBI)