CAS 53205-17-7 appears in our catalog under these names: 1-(3,5-Dimethyl-4-hydroxyphenyl)-2-nitropropene, 95%, 4'-Hydroxy-3',5-beta-trimethyl-beta-nitrostyrene. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 1g, 500mg, 1000mg, 2000mg.
2,6-dimethyl-4-[(Z)-2-nitroprop-1-enyl]phenol (CAS 53205-17-7) is a chemical compound with the molecular formula C11H13NO3 and a molecular weight of 207.23 g/mol. IUPAC name: 2,6-dimethyl-4-[(Z)-2-nitroprop-1-enyl]phenol. InChIKey: GPYZQKJMBACUMA-TWGQIWQCSA-N.
| Molecular formula | C11H13NO3 |
|---|---|
| Molecular weight | 207.23 g/mol |
| IUPAC name | 2,6-dimethyl-4-[(Z)-2-nitroprop-1-enyl]phenol |
| InChIKey | GPYZQKJMBACUMA-TWGQIWQCSA-N |
| SMILES | CC1=CC(=CC(=C1O)C)/C=C(/C)\[N+](=O)[O-] |
Computed by PubChem (NCBI)