CAS 5338-44-3 appears in our catalog under these names: N-Acetyl Benzocaine, Ethyl 4-Acetamidobenzoate, >95% (HPLC), N-Acetylbenzocaine, Ethyl 4-acetamidobenzoate 98%, Ethyl 4-Acetamidobenzoate, 98%, 98%. Offered by: Chemat Brand, TRC, Mikromol, Ambeed, Chemat. Available pack sizes: on request, 25g, 500mg, 25mg, 100mg, 250mg, 1g, 5g.
Ethyl 4-acetamidobenzoate (CAS 5338-44-3) is a chemical compound with the molecular formula C11H13NO3 and a molecular weight of 207.23 g/mol. IUPAC name: ethyl 4-acetamidobenzoate. InChIKey: NHLOBHNRBWKNIO-UHFFFAOYSA-N.
| Molecular formula | C11H13NO3 |
|---|---|
| Molecular weight | 207.23 g/mol |
| IUPAC name | ethyl 4-acetamidobenzoate |
| InChIKey | NHLOBHNRBWKNIO-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC=C(C=C1)NC(=O)C |
Computed by PubChem (NCBI)