Products 53386-96-2
CAS 53386-96-2 is the registry number for Ethyl α-oxo-2-dibenzofuranacetate, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
Ethyl 2-dibenzofuran-2-yl-2-oxoacetate (CAS 53386-96-2) is a chemical compound with the molecular formula C16H12O4 and a molecular weight of 268.26 g/mol. IUPAC name: ethyl 2-dibenzofuran-2-yl-2-oxoacetate. InChIKey: KJYZIHZWPCUEID-UHFFFAOYSA-N.
| Molecular formula | C16H12O4 |
|---|---|
| Molecular weight | 268.26 g/mol |
| IUPAC name | ethyl 2-dibenzofuran-2-yl-2-oxoacetate |
| InChIKey | KJYZIHZWPCUEID-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(=O)C1=CC2=C(C=C1)OC3=CC=CC=C32 |
Computed by PubChem (NCBI)