Products 53618-29-4
CAS 53618-29-4 appears in our catalog under these names: Ethyl 2-methyl-3-(4-nitrophenyl)prop-2-enoate, 95%, Ethyl 2-methyl-3-(4-nitrophenyl)prop-2-enoate. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 100mg, 1g.
Ethyl 2-methyl-3-(4-nitrophenyl)prop-2-enoate (CAS 53618-29-4) is a chemical compound with the molecular formula C12H13NO4 and a molecular weight of 235.24 g/mol. IUPAC name: ethyl 2-methyl-3-(4-nitrophenyl)prop-2-enoate. InChIKey: MMMHCLCYSGLACG-UHFFFAOYSA-N.
| Molecular formula | C12H13NO4 |
|---|---|
| Molecular weight | 235.24 g/mol |
| IUPAC name | ethyl 2-methyl-3-(4-nitrophenyl)prop-2-enoate |
| InChIKey | MMMHCLCYSGLACG-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(=CC1=CC=C(C=C1)[N+](=O)[O-])C |
Computed by PubChem (NCBI)