Products 53821-46-8

CAS 53821-46-8 is the registry number for Methyl 3-methylquinoline-2-carboxylate. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

Methyl 3-methylquinoline-2-carboxylate (CAS 53821-46-8) is a chemical compound with the molecular formula C12H11NO2 and a molecular weight of 201.22 g/mol. IUPAC name: methyl 3-methylquinoline-2-carboxylate. InChIKey: QPMSEXVWDWSUNK-UHFFFAOYSA-N.

Identity
Molecular formulaC12H11NO2
Molecular weight201.22 g/mol
IUPAC namemethyl 3-methylquinoline-2-carboxylate
InChIKeyQPMSEXVWDWSUNK-UHFFFAOYSA-N
SMILESCC1=CC2=CC=CC=C2N=C1C(=O)OC

Computed by PubChem (NCBI)