Products 53948-09-7
CAS 53948-09-7 appears in our catalog under these names: Cepharanone B, Cepharanone B, 99.12%, Aristolactam BII, 97.5%. Offered by: GLPBio, MedChemExpress, Chemat. Available pack sizes: 1mg, 1 mg, 5mg.
14,15-dimethoxy-10-azatetracyclo[7.6.1.02,7.012,16]hexadeca-1(16),2,4,6,8,12,14-heptaen-11-one (CAS 53948-09-7) is a chemical compound with the molecular formula C17H13NO3 and a molecular weight of 279.29 g/mol. IUPAC name: 14,15-dimethoxy-10-azatetracyclo[7.6.1.02,7.012,16]hexadeca-1(16),2,4,6,8,12,14-heptaen-11-one. InChIKey: YHQIYHDLBZXUON-UHFFFAOYSA-N.
| Molecular formula | C17H13NO3 |
|---|---|
| Molecular weight | 279.29 g/mol |
| IUPAC name | 14,15-dimethoxy-10-azatetracyclo[7.6.1.02,7.012,16]hexadeca-1(16),2,4,6,8,12,14-heptaen-11-one |
| InChIKey | YHQIYHDLBZXUON-UHFFFAOYSA-N |
| SMILES | COC1=C(C2=C3C(=C1)C(=O)NC3=CC4=CC=CC=C42)OC |
Computed by PubChem (NCBI)