Products 53948-10-0
CAS 53948-10-0 appears in our catalog under these names: 1,2,9-Trimethoxydibenz(cd,f)indol-4(5H)-one, Aristolactam BIII. Offered by: Biosynth, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, Get quote.
4,14,15-trimethoxy-10-azatetracyclo[7.6.1.02,7.012,16]hexadeca-1,3,5,7,9(16),12,14-heptaen-11-one (CAS 53948-10-0) is a chemical compound with the molecular formula C18H15NO4 and a molecular weight of 309.3 g/mol. IUPAC name: 4,14,15-trimethoxy-10-azatetracyclo[7.6.1.02,7.012,16]hexadeca-1,3,5,7,9(16),12,14-heptaen-11-one. InChIKey: OQKGOEOSXXHWFQ-UHFFFAOYSA-N.
| Molecular formula | C18H15NO4 |
|---|---|
| Molecular weight | 309.3 g/mol |
| IUPAC name | 4,14,15-trimethoxy-10-azatetracyclo[7.6.1.02,7.012,16]hexadeca-1,3,5,7,9(16),12,14-heptaen-11-one |
| InChIKey | OQKGOEOSXXHWFQ-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C3C4=C(C=C2C=C1)NC(=O)C4=CC(=C3OC)OC |
Computed by PubChem (NCBI)