CAS 5397-13-7 appears in our catalog under these names: 5-(4-Chlorophenyl)-5-methylimidazolidine-2,4-dione, 95%, 5-(4-Chlorophenyl)-5-methylimidazolidine-2,4-dione. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 100mg, 1g.
5-(4-chlorophenyl)-5-methylimidazolidine-2,4-dione (CAS 5397-13-7) is a chemical compound with the molecular formula C10H9ClN2O2 and a molecular weight of 224.64 g/mol. IUPAC name: 5-(4-chlorophenyl)-5-methylimidazolidine-2,4-dione. InChIKey: FJMQOXCSOMULOY-UHFFFAOYSA-N.
| Molecular formula | C10H9ClN2O2 |
|---|---|
| Molecular weight | 224.64 g/mol |
| IUPAC name | 5-(4-chlorophenyl)-5-methylimidazolidine-2,4-dione |
| InChIKey | FJMQOXCSOMULOY-UHFFFAOYSA-N |
| SMILES | CC1(C(=O)NC(=O)N1)C2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)