CAS 54063-51-3 appears in our catalog under these names: Nadoxolol, 98%, Nadoxolol. Offered by: Chemat Brand, MedChemExpress. Available pack sizes: on request, Get quote.
N',3-dihydroxy-4-naphthalen-1-yloxybutanimidamide (CAS 54063-51-3) is a chemical compound with the molecular formula C14H16N2O3 and a molecular weight of 260.29 g/mol. IUPAC name: N',3-dihydroxy-4-naphthalen-1-yloxybutanimidamide. InChIKey: UPZVYDSBLFNMLK-UHFFFAOYSA-N.
| Molecular formula | C14H16N2O3 |
|---|---|
| Molecular weight | 260.29 g/mol |
| IUPAC name | N',3-dihydroxy-4-naphthalen-1-yloxybutanimidamide |
| InChIKey | UPZVYDSBLFNMLK-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC=C2OCC(C/C(=N/O)/N)O |
Computed by PubChem (NCBI)